About diiodonickel;ethyl(triphenyl)phosphanium
diiodonickel;ethyl(triphenyl)phosphanium (PubChem CID 160550890) has the molecular formula C20H20I2NiP+
and a molecular weight of 603.86 g/mol. Its IUPAC name is diiodonickel;ethyl(triphenyl)phosphanium.
Molecular Properties
| Compound Name | diiodonickel;ethyl(triphenyl)phosphanium |
| PubChem CID | 160550890 |
| Molecular Formula | C20H20I2NiP+ |
| Molecular Weight | 603.86 g/mol |
| Exact Mass | 602.87 |
| IUPAC Name | diiodonickel;ethyl(triphenyl)phosphanium |
| SMILES | CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.I[Ni]I |
| InChI | InChI=1S/C20H20P.2HI.Ni/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;;;/h3-17H,2H2,1H3;2*1H;/q+1;;;+2/p-2 |
| InChIKey | QYBBRELTSQFJKF-UHFFFAOYSA-L |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 603.86 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diiodonickel;ethyl(triphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diiodonickel;ethyl(triphenyl)phosphanium?
The IUPAC name of diiodonickel;ethyl(triphenyl)phosphanium (CID 160550890) is diiodonickel;ethyl(triphenyl)phosphanium.
What is the SMILES notation for diiodonickel;ethyl(triphenyl)phosphanium?
The canonical SMILES for diiodonickel;ethyl(triphenyl)phosphanium is CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.I[Ni]I.
What is the InChIKey of diiodonickel;ethyl(triphenyl)phosphanium?
The InChIKey is QYBBRELTSQFJKF-UHFFFAOYSA-L. The full InChI is InChI=1S/C20H20P.2HI.Ni/c1-2-21(18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;;;/h3-17H,2H2,1H3;2*1H;/q+1;;;+2/p-2.
What are the key properties of diiodonickel;ethyl(triphenyl)phosphanium?
diiodonickel;ethyl(triphenyl)phosphanium has a molecular weight of 603.86 g/mol, XLogP of 5.77, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diiodonickel;ethyl(triphenyl)phosphanium is sourced from PubChem (CID 160550890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).