C35H32O2P+ — CID 6332817
(3-hydroxy-2-methyl-4-oxo-3,4-diphenylbutyl)-triphenylphosphanium (PubChem CID 6332817) has the molecular formula C35H32O2P+ and a molecular weight of 515.61 g/mol. Its IUPAC name is (3-hydroxy-2-methyl-4-oxo-3,4-diphenylbutyl)-triphenylphosphanium.
| Compound Name | (3-hydroxy-2-methyl-4-oxo-3,4-diphenylbutyl)-triphenylphosphanium |
|---|---|
| PubChem CID | 6332817 |
| Molecular Formula | C35H32O2P+ |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | (3-hydroxy-2-methyl-4-oxo-3,4-diphenylbutyl)-triphenylphosphanium |
| SMILES | CC(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(O)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H32O2P/c1-28(35(37,30-19-9-3-10-20-30)34(36)29-17-7-2-8-18-29)27-38(31-21-11-4-12-22-31,32-23-13-5-14-24-32)33-25-15-6-16-26-33/h2-26,28,37H,27H2,1H3/q+1 |
| InChIKey | OXMFEOYDQZQGAV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|