C23H22F3INOP — CID 74081310
triphenyl-[2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide (PubChem CID 74081310) has the molecular formula C23H22F3INOP and a molecular weight of 543.31 g/mol. Its IUPAC name is triphenyl-[2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide.
| Compound Name | triphenyl-[2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide |
|---|---|
| PubChem CID | 74081310 |
| Molecular Formula | C23H22F3INOP |
| Molecular Weight | 543.31 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | triphenyl-[2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide |
| SMILES | CC(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C(F)(F)F.[I-] |
| InChI | InChI=1S/C23H21F3NOP.HI/c1-18(27-22(28)23(24,25)26)17-29(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;/h2-16,18H,17H2,1H3;1H |
| InChIKey | GXIFGGMYCIQMJN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|