C22H27F3NO5P — CID 147027124
dibenzyl [2-methyl-4-[(2,2,2-trifluoroacetyl)amino]pentyl] phosphate (PubChem CID 147027124) has the molecular formula C22H27F3NO5P and a molecular weight of 473.43 g/mol. Its IUPAC name is dibenzyl [2-methyl-4-[(2,2,2-trifluoroacetyl)amino]pentyl] phosphate.
| Compound Name | dibenzyl [2-methyl-4-[(2,2,2-trifluoroacetyl)amino]pentyl] phosphate |
|---|---|
| PubChem CID | 147027124 |
| Molecular Formula | C22H27F3NO5P |
| Molecular Weight | 473.43 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | dibenzyl [2-methyl-4-[(2,2,2-trifluoroacetyl)amino]pentyl] phosphate |
| SMILES | CC(COP(=O)(OCc1ccccc1)OCc1ccccc1)CC(C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H27F3NO5P/c1-17(13-18(2)26-21(27)22(23,24)25)14-29-32(28,30-15-19-9-5-3-6-10-19)31-16-20-11-7-4-8-12-20/h3-12,17-18H,13-16H2,1-2H3,(H,26,27) |
| InChIKey | AWWHTRPLSWDZOO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|