C23H27F3NO7P — CID 15296071
propan-2-yl (2S,3R)-4-bis(phenylmethoxy)phosphoryloxy-3-deuterio-2-[(2,2,2-trifluoroacetyl)amino]butanoate (PubChem CID 15296071) has the molecular formula C23H27F3NO7P and a molecular weight of 518.44 g/mol. Its IUPAC name is propan-2-yl (2S,3R)-4-bis(phenylmethoxy)phosphoryloxy-3-deuterio-2-[(2,2,2-trifluoroacetyl)amino]butanoate.
| Compound Name | propan-2-yl (2S,3R)-4-bis(phenylmethoxy)phosphoryloxy-3-deuterio-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
|---|---|
| PubChem CID | 15296071 |
| Molecular Formula | C23H27F3NO7P |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | propan-2-yl (2S,3R)-4-bis(phenylmethoxy)phosphoryloxy-3-deuterio-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
| SMILES | [2H][C@@H](COP(=O)(OCc1ccccc1)OCc1ccccc1)[C@H](NC(=O)C(F)(F)F)C(=O)OC(C)C |
| InChI | InChI=1S/C23H27F3NO7P/c1-17(2)34-21(28)20(27-22(29)23(24,25)26)13-14-31-35(30,32-15-18-9-5-3-6-10-18)33-16-19-11-7-4-8-12-19/h3-12,17,20H,13-16H2,1-2H3,(H,27,29)/t20-/m0/s1/i13D/t13-,20- |
| InChIKey | LLRKZEUPQBPMDU-BECWQAPUSA-N |
| XLogP | 4.93 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|