C23H27F3NO6P — CID 10791569
propan-2-yl (2S)-4-bis(phenylmethoxy)phosphanyloxy-2-deuterio-2-[(2,2,2-trifluoroacetyl)amino]butanoate (PubChem CID 10791569) has the molecular formula C23H27F3NO6P and a molecular weight of 502.44 g/mol. Its IUPAC name is propan-2-yl (2S)-4-bis(phenylmethoxy)phosphanyloxy-2-deuterio-2-[(2,2,2-trifluoroacetyl)amino]butanoate.
| Compound Name | propan-2-yl (2S)-4-bis(phenylmethoxy)phosphanyloxy-2-deuterio-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
|---|---|
| PubChem CID | 10791569 |
| Molecular Formula | C23H27F3NO6P |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | propan-2-yl (2S)-4-bis(phenylmethoxy)phosphanyloxy-2-deuterio-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
| SMILES | [2H][C@@](CCOP(OCc1ccccc1)OCc1ccccc1)(NC(=O)C(F)(F)F)C(=O)OC(C)C |
| InChI | InChI=1S/C23H27F3NO6P/c1-17(2)33-21(28)20(27-22(29)23(24,25)26)13-14-30-34(31-15-18-9-5-3-6-10-18)32-16-19-11-7-4-8-12-19/h3-12,17,20H,13-16H2,1-2H3,(H,27,29)/t20-/m0/s1/i20D |
| InChIKey | NATBVEBDJBPYGO-HIDRZSPHSA-N |
| XLogP | 5.05 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|