C34H40O10P2 — CID 88543969
dibenzyl [3-bis(phenylmethoxy)phosphoryloxy-2-(2-methoxyethoxy)propyl] phosphate (PubChem CID 88543969) has the molecular formula C34H40O10P2 and a molecular weight of 670.63 g/mol. Its IUPAC name is dibenzyl [3-bis(phenylmethoxy)phosphoryloxy-2-(2-methoxyethoxy)propyl] phosphate.
| Compound Name | dibenzyl [3-bis(phenylmethoxy)phosphoryloxy-2-(2-methoxyethoxy)propyl] phosphate |
|---|---|
| PubChem CID | 88543969 |
| Molecular Formula | C34H40O10P2 |
| Molecular Weight | 670.63 g/mol |
| Exact Mass | 670.21 |
| IUPAC Name | dibenzyl [3-bis(phenylmethoxy)phosphoryloxy-2-(2-methoxyethoxy)propyl] phosphate |
| SMILES | COCCOC(COP(=O)(OCc1ccccc1)OCc1ccccc1)COP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C34H40O10P2/c1-37-22-23-38-34(28-43-45(35,39-24-30-14-6-2-7-15-30)40-25-31-16-8-3-9-17-31)29-44-46(36,41-26-32-18-10-4-11-19-32)42-27-33-20-12-5-13-21-33/h2-21,34H,22-29H2,1H3 |
| InChIKey | VAJNXMWFBYMSKS-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.63 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|