C24H26BrOP — CID 19850748
(3,3-dimethyl-2-oxobutyl)-triphenylphosphanium bromide (PubChem CID 19850748) has the molecular formula C24H26BrOP and a molecular weight of 441.35 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl)-triphenylphosphanium bromide.
| Compound Name | (3,3-dimethyl-2-oxobutyl)-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 19850748 |
| Molecular Formula | C24H26BrOP |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl)-triphenylphosphanium bromide |
| SMILES | CC(C)(C)C(=O)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C24H26OP.BrH/c1-24(2,3)23(25)19-26(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;/h4-18H,19H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZJEXXLJGCBFPGI-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|