About chloroplatinum;hydroxymethyl(triphenyl)phosphanium
chloroplatinum;hydroxymethyl(triphenyl)phosphanium (PubChem CID 174615744) has the molecular formula C19H18ClOPPt+
and a molecular weight of 523.86 g/mol. Its IUPAC name is chloroplatinum;hydroxymethyl(triphenyl)phosphanium.
Molecular Properties
| Compound Name | chloroplatinum;hydroxymethyl(triphenyl)phosphanium |
| PubChem CID | 174615744 |
| Molecular Formula | C19H18ClOPPt+ |
| Molecular Weight | 523.86 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | chloroplatinum;hydroxymethyl(triphenyl)phosphanium |
| SMILES | Cl[Pt].OC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18OP.ClH.Pt/c20-16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;;/h1-15,20H,16H2;1H;/q+1;;+1/p-1 |
| InChIKey | WWCFCQBUTQLQIV-UHFFFAOYSA-M |
| XLogP | 3.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 523.86 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloroplatinum;hydroxymethyl(triphenyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroplatinum;hydroxymethyl(triphenyl)phosphanium?
The IUPAC name of chloroplatinum;hydroxymethyl(triphenyl)phosphanium (CID 174615744) is chloroplatinum;hydroxymethyl(triphenyl)phosphanium.
What is the SMILES notation for chloroplatinum;hydroxymethyl(triphenyl)phosphanium?
The canonical SMILES for chloroplatinum;hydroxymethyl(triphenyl)phosphanium is Cl[Pt].OC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of chloroplatinum;hydroxymethyl(triphenyl)phosphanium?
The InChIKey is WWCFCQBUTQLQIV-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H18OP.ClH.Pt/c20-16-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19;;/h1-15,20H,16H2;1H;/q+1;;+1/p-1.
What are the key properties of chloroplatinum;hydroxymethyl(triphenyl)phosphanium?
chloroplatinum;hydroxymethyl(triphenyl)phosphanium has a molecular weight of 523.86 g/mol, XLogP of 3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloroplatinum;hydroxymethyl(triphenyl)phosphanium is sourced from PubChem (CID 174615744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).