C30H32BNPSi+ — CID 6365019
CID 6365019 (PubChem CID 6365019) has the molecular formula C30H32BNPSi+ and a molecular weight of 476.47 g/mol.
| Compound Name | CID 6365019 |
|---|---|
| PubChem CID | 6365019 |
| Molecular Formula | C30H32BNPSi+ |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | — |
| SMILES | [B][P+]1(c2ccccc2)c2ccccc2[C@@H](C)N1[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H32BNPSi/c1-24-28-22-14-15-23-29(28)33(31,25-16-8-5-9-17-25)32(24)34(30(2,3)4,26-18-10-6-11-19-26)27-20-12-7-13-21-27/h5-24H,1-4H3/q+1/t24-,33?/m1/s1 |
| InChIKey | CMPIBSZRDGEJCP-HVQYUPJGSA-N |
| XLogP | 5.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|