C24H34N2OSi2 — CID 102145623
1-[(3S,4S)-2-[tert-butyl(diphenyl)silyl]-3-trimethylsilyl-3,4-dihydropyrazol-4-yl]ethanone (PubChem CID 102145623) has the molecular formula C24H34N2OSi2 and a molecular weight of 422.72 g/mol. Its IUPAC name is 1-[(3S,4S)-2-[tert-butyl(diphenyl)silyl]-3-trimethylsilyl-3,4-dihydropyrazol-4-yl]ethanone.
| Compound Name | 1-[(3S,4S)-2-[tert-butyl(diphenyl)silyl]-3-trimethylsilyl-3,4-dihydropyrazol-4-yl]ethanone |
|---|---|
| PubChem CID | 102145623 |
| Molecular Formula | C24H34N2OSi2 |
| Molecular Weight | 422.72 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 1-[(3S,4S)-2-[tert-butyl(diphenyl)silyl]-3-trimethylsilyl-3,4-dihydropyrazol-4-yl]ethanone |
| SMILES | CC(=O)[C@@H]1C=NN([Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C24H34N2OSi2/c1-19(27)22-18-25-26(23(22)28(5,6)7)29(24(2,3)4,20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-18,22-23H,1-7H3/t22-,23-/m0/s1 |
| InChIKey | FFIVZWWODCVXPL-GOTSBHOMSA-N |
| XLogP | 4.30 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|