C25H37ClSi — CID 54497975
chloro-(2,2,3,4,4,5,5-heptamethylhexan-3-yl)-diphenylsilane (PubChem CID 54497975) has the molecular formula C25H37ClSi and a molecular weight of 401.11 g/mol. Its IUPAC name is chloro-(2,2,3,4,4,5,5-heptamethylhexan-3-yl)-diphenylsilane.
| Compound Name | chloro-(2,2,3,4,4,5,5-heptamethylhexan-3-yl)-diphenylsilane |
|---|---|
| PubChem CID | 54497975 |
| Molecular Formula | C25H37ClSi |
| Molecular Weight | 401.11 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | chloro-(2,2,3,4,4,5,5-heptamethylhexan-3-yl)-diphenylsilane |
| SMILES | CC(C)(C)C(C)(C)C(C)(C(C)(C)C)[Si](Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H37ClSi/c1-22(2,3)24(7,8)25(9,23(4,5)6)27(26,20-16-12-10-13-17-20)21-18-14-11-15-19-21/h10-19H,1-9H3 |
| InChIKey | YALKPDIYNLFFJU-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.11 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|