C13H20NOS+ — CID 158139472
tert-butyl-hydroxy-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]sulfanium (PubChem CID 158139472) has the molecular formula C13H20NOS+ and a molecular weight of 238.38 g/mol. Its IUPAC name is tert-butyl-hydroxy-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]sulfanium.
| Compound Name | tert-butyl-hydroxy-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]sulfanium |
|---|---|
| PubChem CID | 158139472 |
| Molecular Formula | C13H20NOS+ |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | tert-butyl-hydroxy-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]sulfanium |
| SMILES | C[C@H]1c2ccccc2CN1[S+](O)C(C)(C)C |
| InChI | InChI=1S/C13H20NOS/c1-10-12-8-6-5-7-11(12)9-14(10)16(15)13(2,3)4/h5-8,10,15H,9H2,1-4H3/q+1/t10-,16?/m0/s1 |
| InChIKey | VVFHXXKEHUUBIS-VQVVDHBBSA-N |
| XLogP | 3.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|