C12H16N2 — CID 156894592
ethane;1-methyl-1,3-dihydroisoindole-2-carbonitrile (PubChem CID 156894592) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is ethane;1-methyl-1,3-dihydroisoindole-2-carbonitrile.
| Compound Name | ethane;1-methyl-1,3-dihydroisoindole-2-carbonitrile |
|---|---|
| PubChem CID | 156894592 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | ethane;1-methyl-1,3-dihydroisoindole-2-carbonitrile |
| SMILES | CC.CC1c2ccccc2CN1C#N |
| InChI | InChI=1S/C10H10N2.C2H6/c1-8-10-5-3-2-4-9(10)6-12(8)7-11;1-2/h2-5,8H,6H2,1H3;1-2H3 |
| InChIKey | RLOKKSPFGUJIKD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|