C12H15N — CID 12953710
2-cyclopropyl-1-methyl-1,3-dihydroisoindole (PubChem CID 12953710) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-cyclopropyl-1-methyl-1,3-dihydroisoindole.
| Compound Name | 2-cyclopropyl-1-methyl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 12953710 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-cyclopropyl-1-methyl-1,3-dihydroisoindole |
| SMILES | CC1c2ccccc2CN1C1CC1 |
| InChI | InChI=1S/C12H15N/c1-9-12-5-3-2-4-10(12)8-13(9)11-6-7-11/h2-5,9,11H,6-8H2,1H3 |
| InChIKey | KSYQPIUWRJTVHH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |