C12H15NO — CID 12953765
(2-cyclopropyl-1,3-dihydroisoindol-1-yl)methanol (PubChem CID 12953765) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (2-cyclopropyl-1,3-dihydroisoindol-1-yl)methanol.
| Compound Name | (2-cyclopropyl-1,3-dihydroisoindol-1-yl)methanol |
|---|---|
| PubChem CID | 12953765 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (2-cyclopropyl-1,3-dihydroisoindol-1-yl)methanol |
| SMILES | OCC1c2ccccc2CN1C1CC1 |
| InChI | InChI=1S/C12H15NO/c14-8-12-11-4-2-1-3-9(11)7-13(12)10-5-6-10/h1-4,10,12,14H,5-8H2 |
| InChIKey | PPNBGEAPCLQAPR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |