About 12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene
12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene (PubChem CID 54209390) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene.
Analyze 12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene?
The IUPAC name of 12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene (CID 54209390) is 12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene.
What is the SMILES notation for 12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene?
The canonical SMILES for 12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene is CCN1CCN2Cc3ccccc3C1C2.
What is the InChIKey of 12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene?
The InChIKey is PUWDIXDEJJNLHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-2-15-8-7-14-9-11-5-3-4-6-12(11)13(15)10-14/h3-6,13H,2,7-10H2,1H3.
What are the key properties of 12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene?
12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene has a molecular weight of 202.30 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-ethyl-9,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene is sourced from PubChem (CID 54209390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).