C13H18N2 — CID 84670912
1-(2-ethyl-1,3-dihydroisoindol-1-yl)cyclopropan-1-amine (PubChem CID 84670912) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-(2-ethyl-1,3-dihydroisoindol-1-yl)cyclopropan-1-amine.
| Compound Name | 1-(2-ethyl-1,3-dihydroisoindol-1-yl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 84670912 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-(2-ethyl-1,3-dihydroisoindol-1-yl)cyclopropan-1-amine |
| SMILES | CCN1Cc2ccccc2C1C1(N)CC1 |
| InChI | InChI=1S/C13H18N2/c1-2-15-9-10-5-3-4-6-11(10)12(15)13(14)7-8-13/h3-6,12H,2,7-9,14H2,1H3 |
| InChIKey | GQPLHILBLVBRBN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |