About (1R)-1,2-ditert-butyl-1,3-dihydroisoindole
(1R)-1,2-ditert-butyl-1,3-dihydroisoindole (PubChem CID 146435754) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is (1R)-1,2-ditert-butyl-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | (1R)-1,2-ditert-butyl-1,3-dihydroisoindole |
| PubChem CID | 146435754 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (1R)-1,2-ditert-butyl-1,3-dihydroisoindole |
| SMILES | CC(C)(C)[C@@H]1c2ccccc2CN1C(C)(C)C |
| InChI | InChI=1S/C16H25N/c1-15(2,3)14-13-10-8-7-9-12(13)11-17(14)16(4,5)6/h7-10,14H,11H2,1-6H3/t14-/m0/s1 |
| InChIKey | WBQOESBXEBDFNN-AWEZNQCLSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1,2-ditert-butyl-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1,2-ditert-butyl-1,3-dihydroisoindole?
The IUPAC name of (1R)-1,2-ditert-butyl-1,3-dihydroisoindole (CID 146435754) is (1R)-1,2-ditert-butyl-1,3-dihydroisoindole.
What is the SMILES notation for (1R)-1,2-ditert-butyl-1,3-dihydroisoindole?
The canonical SMILES for (1R)-1,2-ditert-butyl-1,3-dihydroisoindole is CC(C)(C)[C@@H]1c2ccccc2CN1C(C)(C)C.
What is the InChIKey of (1R)-1,2-ditert-butyl-1,3-dihydroisoindole?
The InChIKey is WBQOESBXEBDFNN-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H25N/c1-15(2,3)14-13-10-8-7-9-12(13)11-17(14)16(4,5)6/h7-10,14H,11H2,1-6H3/t14-/m0/s1.
What are the key properties of (1R)-1,2-ditert-butyl-1,3-dihydroisoindole?
(1R)-1,2-ditert-butyl-1,3-dihydroisoindole has a molecular weight of 231.38 g/mol, XLogP of 4.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1,2-ditert-butyl-1,3-dihydroisoindole is sourced from PubChem (CID 146435754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).