C11H14FN — CID 91043961
3-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 91043961) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is 3-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 3-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 91043961 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 3-fluoro-1,2-dimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CC1c2ccccc2CC(F)N1C |
| InChI | InChI=1S/C11H14FN/c1-8-10-6-4-3-5-9(10)7-11(12)13(8)2/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | ARTOEBNOVZIHMC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|