C13H15NO2 — CID 163388945
(1S)-1,5-dimethyl-1,5,10,10a-tetrahydro-[1,3]oxazolo[3,4-b]isoquinolin-3-one (PubChem CID 163388945) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (1S)-1,5-dimethyl-1,5,10,10a-tetrahydro-[1,3]oxazolo[3,4-b]isoquinolin-3-one.
| Compound Name | (1S)-1,5-dimethyl-1,5,10,10a-tetrahydro-[1,3]oxazolo[3,4-b]isoquinolin-3-one |
|---|---|
| PubChem CID | 163388945 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (1S)-1,5-dimethyl-1,5,10,10a-tetrahydro-[1,3]oxazolo[3,4-b]isoquinolin-3-one |
| SMILES | CC1c2ccccc2CC2[C@H](C)OC(=O)N12 |
| InChI | InChI=1S/C13H15NO2/c1-8-11-6-4-3-5-10(11)7-12-9(2)16-13(15)14(8)12/h3-6,8-9,12H,7H2,1-2H3/t8?,9-,12?/m0/s1 |
| InChIKey | FDUFNWUOPZXRJB-XEVUQIKYSA-N |
| XLogP | 2.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |