C14H19NO — CID 129392431
4-[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]morpholine (PubChem CID 129392431) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 4-[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]morpholine.
| Compound Name | 4-[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]morpholine |
|---|---|
| PubChem CID | 129392431 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 4-[(1S,2S)-1-methyl-2,3-dihydro-1H-inden-2-yl]morpholine |
| SMILES | C[C@H]1c2ccccc2C[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C14H19NO/c1-11-13-5-3-2-4-12(13)10-14(11)15-6-8-16-9-7-15/h2-5,11,14H,6-10H2,1H3/t11-,14-/m0/s1 |
| InChIKey | KPJZLIJJCUHHGC-FZMZJTMJSA-N |
| XLogP | 2.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |