About 3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole
3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole (PubChem CID 11435240) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole.
Analyze 3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole?
The IUPAC name of 3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole (CID 11435240) is 3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole.
What is the SMILES notation for 3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole?
The canonical SMILES for 3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole is c1ccc2c(c1)CN1CCOCC21.
What is the InChIKey of 3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole?
The InChIKey is FXGXAVKJZHCZHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-2-4-10-9(3-1)7-12-5-6-13-8-11(10)12/h1-4,11H,5-8H2.
What are the key properties of 3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole?
3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole has a molecular weight of 175.23 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,6,10b-tetrahydro-1H-[1,4]oxazino[3,4-a]isoindole is sourced from PubChem (CID 11435240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).