C15H21NO — CID 97302014
1-[(2S,3S)-2-methyl-3,4-dihydro-2H-chromen-3-yl]piperidine (PubChem CID 97302014) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-[(2S,3S)-2-methyl-3,4-dihydro-2H-chromen-3-yl]piperidine.
| Compound Name | 1-[(2S,3S)-2-methyl-3,4-dihydro-2H-chromen-3-yl]piperidine |
|---|---|
| PubChem CID | 97302014 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-[(2S,3S)-2-methyl-3,4-dihydro-2H-chromen-3-yl]piperidine |
| SMILES | C[C@@H]1Oc2ccccc2C[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C15H21NO/c1-12-14(16-9-5-2-6-10-16)11-13-7-3-4-8-15(13)17-12/h3-4,7-8,12,14H,2,5-6,9-11H2,1H3/t12-,14-/m0/s1 |
| InChIKey | UVTDDEOHIXVKQH-JSGCOSHPSA-N |
| XLogP | 2.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |