C14H20N2O — CID 141009186
1-(3,4-dihydro-2H-chromen-2-yl)-4-methylpiperazine (PubChem CID 141009186) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-2-yl)-4-methylpiperazine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-2-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 141009186 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-2-yl)-4-methylpiperazine |
| SMILES | CN1CCN(C2CCc3ccccc3O2)CC1 |
| InChI | InChI=1S/C14H20N2O/c1-15-8-10-16(11-9-15)14-7-6-12-4-2-3-5-13(12)17-14/h2-5,14H,6-11H2,1H3 |
| InChIKey | LJQLSVSWWRSPOO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |