C18H40Si2 — CID 101272528
tert-butyl-[4-[tert-butyl(dimethyl)silyl]cyclohexyl]-dimethylsilane (PubChem CID 101272528) has the molecular formula C18H40Si2 and a molecular weight of 312.69 g/mol. Its IUPAC name is tert-butyl-[4-[tert-butyl(dimethyl)silyl]cyclohexyl]-dimethylsilane.
| Compound Name | tert-butyl-[4-[tert-butyl(dimethyl)silyl]cyclohexyl]-dimethylsilane |
|---|---|
| PubChem CID | 101272528 |
| Molecular Formula | C18H40Si2 |
| Molecular Weight | 312.69 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | tert-butyl-[4-[tert-butyl(dimethyl)silyl]cyclohexyl]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)C1CCC([Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H40Si2/c1-17(2,3)19(7,8)15-11-13-16(14-12-15)20(9,10)18(4,5)6/h15-16H,11-14H2,1-10H3 |
| InChIKey | UPVSKOLFAPHTDE-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.69 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|