C15H29ISi — CID 123595457
tert-butyl-(4-iodo-3,5,5-trimethylcyclohex-3-en-1-yl)-dimethylsilane (PubChem CID 123595457) has the molecular formula C15H29ISi and a molecular weight of 364.39 g/mol. Its IUPAC name is tert-butyl-(4-iodo-3,5,5-trimethylcyclohex-3-en-1-yl)-dimethylsilane.
| Compound Name | tert-butyl-(4-iodo-3,5,5-trimethylcyclohex-3-en-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 123595457 |
| Molecular Formula | C15H29ISi |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | tert-butyl-(4-iodo-3,5,5-trimethylcyclohex-3-en-1-yl)-dimethylsilane |
| SMILES | CC1=C(I)C(C)(C)CC([Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H29ISi/c1-11-9-12(10-15(5,6)13(11)16)17(7,8)14(2,3)4/h12H,9-10H2,1-8H3 |
| InChIKey | VZVWIXMHQAJANJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|