C19H35NO2Si — CID 135020516
tert-butyl-dimethyl-[3,5,5-trimethyl-4-(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)cyclohex-3-en-1-yl]oxysilane (PubChem CID 135020516) has the molecular formula C19H35NO2Si and a molecular weight of 337.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3,5,5-trimethyl-4-(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)cyclohex-3-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[3,5,5-trimethyl-4-(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)cyclohex-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 135020516 |
| Molecular Formula | C19H35NO2Si |
| Molecular Weight | 337.58 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | tert-butyl-dimethyl-[3,5,5-trimethyl-4-(3-methyl-4,5-dihydro-1,2-oxazol-5-yl)cyclohex-3-en-1-yl]oxysilane |
| SMILES | CC1=NOC(C2=C(C)CC(O[Si](C)(C)C(C)(C)C)CC2(C)C)C1 |
| InChI | InChI=1S/C19H35NO2Si/c1-13-10-15(22-23(8,9)18(3,4)5)12-19(6,7)17(13)16-11-14(2)20-21-16/h15-16H,10-12H2,1-9H3 |
| InChIKey | SRKPWSYJJNXQCR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|