C14H24OSi — CID 19751863
(4-ethynyl-3,5,5-trimethylcyclohex-3-en-1-yl)oxy-trimethylsilane (PubChem CID 19751863) has the molecular formula C14H24OSi and a molecular weight of 236.43 g/mol. Its IUPAC name is (4-ethynyl-3,5,5-trimethylcyclohex-3-en-1-yl)oxy-trimethylsilane.
| Compound Name | (4-ethynyl-3,5,5-trimethylcyclohex-3-en-1-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 19751863 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (4-ethynyl-3,5,5-trimethylcyclohex-3-en-1-yl)oxy-trimethylsilane |
| SMILES | C#CC1=C(C)CC(O[Si](C)(C)C)CC1(C)C |
| InChI | InChI=1S/C14H24OSi/c1-8-13-11(2)9-12(10-14(13,3)4)15-16(5,6)7/h1,12H,9-10H2,2-7H3 |
| InChIKey | KZXBGDYVHZQXRD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|