C19H40OSiSn — CID 177470456
tert-butyl-dimethyl-[2,2,4-trimethyl-3-(trimethylstannylmethyl)cyclohex-3-en-1-yl]oxysilane (PubChem CID 177470456) has the molecular formula C19H40OSiSn and a molecular weight of 431.33 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2,2,4-trimethyl-3-(trimethylstannylmethyl)cyclohex-3-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[2,2,4-trimethyl-3-(trimethylstannylmethyl)cyclohex-3-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 177470456 |
| Molecular Formula | C19H40OSiSn |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | tert-butyl-dimethyl-[2,2,4-trimethyl-3-(trimethylstannylmethyl)cyclohex-3-en-1-yl]oxysilane |
| SMILES | CC1=C(C[Sn](C)(C)C)C(C)(C)C(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H31OSi.3CH3.Sn/c1-12-10-11-14(16(6,7)13(12)2)17-18(8,9)15(3,4)5;;;;/h14H,2,10-11H2,1,3-9H3;3*1H3; |
| InChIKey | WASOCQOMDLZJKL-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|