C21H44OSi2 — CID 12007116
tert-butyl-dimethyl-(3,6,6-trimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxysilane (PubChem CID 12007116) has the molecular formula C21H44OSi2 and a molecular weight of 368.75 g/mol. Its IUPAC name is tert-butyl-dimethyl-(3,6,6-trimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxysilane.
| Compound Name | tert-butyl-dimethyl-(3,6,6-trimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxysilane |
|---|---|
| PubChem CID | 12007116 |
| Molecular Formula | C21H44OSi2 |
| Molecular Weight | 368.75 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | tert-butyl-dimethyl-(3,6,6-trimethyl-4-triethylsilylcyclohex-3-en-1-yl)oxysilane |
| SMILES | CC[Si](CC)(CC)C1=C(C)CC(O[Si](C)(C)C(C)(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C21H44OSi2/c1-12-24(13-2,14-3)18-16-21(8,9)19(15-17(18)4)22-23(10,11)20(5,6)7/h19H,12-16H2,1-11H3 |
| InChIKey | OANISPZZOXTCIS-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.75 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|