C20H46OSi4 — CID 101392212
[6-tert-butyl-3,4-dimethyl-1,1-bis(trimethylsilyl)-2,5-dihydrosilin-6-yl]oxy-trimethylsilane (PubChem CID 101392212) has the molecular formula C20H46OSi4 and a molecular weight of 414.93 g/mol. Its IUPAC name is [6-tert-butyl-3,4-dimethyl-1,1-bis(trimethylsilyl)-2,5-dihydrosilin-6-yl]oxy-trimethylsilane.
| Compound Name | [6-tert-butyl-3,4-dimethyl-1,1-bis(trimethylsilyl)-2,5-dihydrosilin-6-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101392212 |
| Molecular Formula | C20H46OSi4 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | [6-tert-butyl-3,4-dimethyl-1,1-bis(trimethylsilyl)-2,5-dihydrosilin-6-yl]oxy-trimethylsilane |
| SMILES | CC1=C(C)C[Si]([Si](C)(C)C)([Si](C)(C)C)C(O[Si](C)(C)C)(C(C)(C)C)C1 |
| InChI | InChI=1S/C20H46OSi4/c1-17-15-20(19(3,4)5,21-22(6,7)8)25(16-18(17)2,23(9,10)11)24(12,13)14/h15-16H2,1-14H3 |
| InChIKey | RCGJWSQVZCAAFV-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|