C19H44OSi4 — CID 102468825
[3,4-dimethyl-6-propan-2-yl-1,1-bis(trimethylsilyl)-2,5-dihydrosilin-6-yl]oxy-trimethylsilane (PubChem CID 102468825) has the molecular formula C19H44OSi4 and a molecular weight of 400.90 g/mol. Its IUPAC name is [3,4-dimethyl-6-propan-2-yl-1,1-bis(trimethylsilyl)-2,5-dihydrosilin-6-yl]oxy-trimethylsilane.
| Compound Name | [3,4-dimethyl-6-propan-2-yl-1,1-bis(trimethylsilyl)-2,5-dihydrosilin-6-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 102468825 |
| Molecular Formula | C19H44OSi4 |
| Molecular Weight | 400.90 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | [3,4-dimethyl-6-propan-2-yl-1,1-bis(trimethylsilyl)-2,5-dihydrosilin-6-yl]oxy-trimethylsilane |
| SMILES | CC1=C(C)C[Si]([Si](C)(C)C)([Si](C)(C)C)C(O[Si](C)(C)C)(C(C)C)C1 |
| InChI | InChI=1S/C19H44OSi4/c1-16(2)19(20-21(5,6)7)14-17(3)18(4)15-24(19,22(8,9)10)23(11,12)13/h16H,14-15H2,1-13H3 |
| InChIKey | VXLYCILLUJHFFV-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.90 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|