C21H34O2Si — CID 11256500
(1S,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-2-(4-methylphenyl)cyclopentane-1-carbaldehyde (PubChem CID 11256500) has the molecular formula C21H34O2Si and a molecular weight of 346.59 g/mol. Its IUPAC name is (1S,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-2-(4-methylphenyl)cyclopentane-1-carbaldehyde.
| Compound Name | (1S,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-2-(4-methylphenyl)cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 11256500 |
| Molecular Formula | C21H34O2Si |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (1S,2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-2-(4-methylphenyl)cyclopentane-1-carbaldehyde |
| SMILES | Cc1ccc([C@]2(C)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@]2(C)C=O)cc1 |
| InChI | InChI=1S/C21H34O2Si/c1-16-9-11-17(12-10-16)21(6)14-18(13-20(21,5)15-22)23-24(7,8)19(2,3)4/h9-12,15,18H,13-14H2,1-8H3/t18-,20+,21-/m0/s1 |
| InChIKey | LVFVUFFEGLSHEQ-TYPHKJRUSA-N |
| XLogP | 5.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|