C20H37BrN2O2Si2 — CID 140746347
[1-(5-bromopyrimidin-2-yl)-3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]oxy-tert-butyl-dimethylsilane (PubChem CID 140746347) has the molecular formula C20H37BrN2O2Si2 and a molecular weight of 473.60 g/mol. Its IUPAC name is [1-(5-bromopyrimidin-2-yl)-3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [1-(5-bromopyrimidin-2-yl)-3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 140746347 |
| Molecular Formula | C20H37BrN2O2Si2 |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | [1-(5-bromopyrimidin-2-yl)-3-[tert-butyl(dimethyl)silyl]oxycyclobutyl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(O[Si](C)(C)C(C)(C)C)(c2ncc(Br)cn2)C1 |
| InChI | InChI=1S/C20H37BrN2O2Si2/c1-18(2,3)26(7,8)24-16-11-20(12-16,17-22-13-15(21)14-23-17)25-27(9,10)19(4,5)6/h13-14,16H,11-12H2,1-10H3 |
| InChIKey | RLTOGXQYGPUQEO-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|