C14H21BrClNOSi — CID 156803230
[1-(5-bromo-3-chloro-2-pyridinyl)cyclopropyl]oxy-tert-butyl-dimethylsilane (PubChem CID 156803230) has the molecular formula C14H21BrClNOSi and a molecular weight of 362.77 g/mol. Its IUPAC name is [1-(5-bromo-3-chloro-2-pyridinyl)cyclopropyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [1-(5-bromo-3-chloro-2-pyridinyl)cyclopropyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 156803230 |
| Molecular Formula | C14H21BrClNOSi |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | [1-(5-bromo-3-chloro-2-pyridinyl)cyclopropyl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1(c2ncc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C14H21BrClNOSi/c1-13(2,3)19(4,5)18-14(6-7-14)12-11(16)8-10(15)9-17-12/h8-9H,6-7H2,1-5H3 |
| InChIKey | SQCSULGJCRWPPT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|