C18H28ClNO2Si — CID 174049180
tert-butyl-[1-[3-chloro-4-(2-ethoxyethenyl)-2-pyridinyl]cyclopropyl]oxy-dimethylsilane (PubChem CID 174049180) has the molecular formula C18H28ClNO2Si and a molecular weight of 353.97 g/mol. Its IUPAC name is tert-butyl-[1-[3-chloro-4-(2-ethoxyethenyl)-2-pyridinyl]cyclopropyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[1-[3-chloro-4-(2-ethoxyethenyl)-2-pyridinyl]cyclopropyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 174049180 |
| Molecular Formula | C18H28ClNO2Si |
| Molecular Weight | 353.97 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | tert-butyl-[1-[3-chloro-4-(2-ethoxyethenyl)-2-pyridinyl]cyclopropyl]oxy-dimethylsilane |
| SMILES | CCOC=Cc1ccnc(C2(O[Si](C)(C)C(C)(C)C)CC2)c1Cl |
| InChI | InChI=1S/C18H28ClNO2Si/c1-7-21-13-9-14-8-12-20-16(15(14)19)18(10-11-18)22-23(5,6)17(2,3)4/h8-9,12-13H,7,10-11H2,1-6H3 |
| InChIKey | NSOUQNDCGKUBRL-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.97 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|