C14H16ClN3O — CID 89027521
2-chloro-5-[(E)-2-ethoxyethenyl]-N-(3-tricyclo[3.1.0.01,3]hexanyl)pyrimidin-4-amine (PubChem CID 89027521) has the molecular formula C14H16ClN3O and a molecular weight of 277.76 g/mol. Its IUPAC name is 2-chloro-5-[(E)-2-ethoxyethenyl]-N-(3-tricyclo[3.1.0.01,3]hexanyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-5-[(E)-2-ethoxyethenyl]-N-(3-tricyclo[3.1.0.01,3]hexanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 89027521 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-chloro-5-[(E)-2-ethoxyethenyl]-N-(3-tricyclo[3.1.0.01,3]hexanyl)pyrimidin-4-amine |
| SMILES | CCO/C=C/c1cnc(Cl)nc1NC12CC3CC31C2 |
| InChI | InChI=1S/C14H16ClN3O/c1-2-19-4-3-9-7-16-12(15)17-11(9)18-14-6-10-5-13(10,14)8-14/h3-4,7,10H,2,5-6,8H2,1H3,(H,16,17,18)/b4-3+ |
| InChIKey | IXTUUNKUEMZELH-ONEGZZNKSA-N |
| XLogP | 3.10 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|