C10H12Cl2N2O — CID 46934604
4-[(E)-2-butoxyethenyl]-2,5-dichloropyrimidine (PubChem CID 46934604) has the molecular formula C10H12Cl2N2O and a molecular weight of 247.12 g/mol. Its IUPAC name is 4-[(E)-2-butoxyethenyl]-2,5-dichloropyrimidine.
| Compound Name | 4-[(E)-2-butoxyethenyl]-2,5-dichloropyrimidine |
|---|---|
| PubChem CID | 46934604 |
| Molecular Formula | C10H12Cl2N2O |
| Molecular Weight | 247.12 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | 4-[(E)-2-butoxyethenyl]-2,5-dichloropyrimidine |
| SMILES | CCCCO/C=C/c1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O/c1-2-3-5-15-6-4-9-8(11)7-13-10(12)14-9/h4,6-7H,2-3,5H2,1H3/b6-4+ |
| InChIKey | MCKAZCQKSORSST-GQCTYLIASA-N |
| XLogP | 3.57 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.12 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|