About 2-butoxy-3,5-dichloropyridin-4-amine
2-butoxy-3,5-dichloropyridin-4-amine (PubChem CID 21388649) has the molecular formula C9H12Cl2N2O
and a molecular weight of 235.11 g/mol. Its IUPAC name is 2-butoxy-3,5-dichloropyridin-4-amine.
Molecular Properties
| Compound Name | 2-butoxy-3,5-dichloropyridin-4-amine |
| PubChem CID | 21388649 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-butoxy-3,5-dichloropyridin-4-amine |
| SMILES | CCCCOc1ncc(Cl)c(N)c1Cl |
| InChI | InChI=1S/C9H12Cl2N2O/c1-2-3-4-14-9-7(11)8(12)6(10)5-13-9/h5H,2-4H2,1H3,(H2,12,13) |
| InChIKey | ZDBFSQZBNNUMJQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxy-3,5-dichloropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxy-3,5-dichloropyridin-4-amine?
The IUPAC name of 2-butoxy-3,5-dichloropyridin-4-amine (CID 21388649) is 2-butoxy-3,5-dichloropyridin-4-amine.
What is the SMILES notation for 2-butoxy-3,5-dichloropyridin-4-amine?
The canonical SMILES for 2-butoxy-3,5-dichloropyridin-4-amine is CCCCOc1ncc(Cl)c(N)c1Cl.
What is the InChIKey of 2-butoxy-3,5-dichloropyridin-4-amine?
The InChIKey is ZDBFSQZBNNUMJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2N2O/c1-2-3-4-14-9-7(11)8(12)6(10)5-13-9/h5H,2-4H2,1H3,(H2,12,13).
What are the key properties of 2-butoxy-3,5-dichloropyridin-4-amine?
2-butoxy-3,5-dichloropyridin-4-amine has a molecular weight of 235.11 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxy-3,5-dichloropyridin-4-amine is sourced from PubChem (CID 21388649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).