C14H20N2O2 — CID 10848171
N-[3-[(E)-2-butoxyethenyl]-5-methyl-2-pyridinyl]acetamide (PubChem CID 10848171) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-[3-[(E)-2-butoxyethenyl]-5-methyl-2-pyridinyl]acetamide.
| Compound Name | N-[3-[(E)-2-butoxyethenyl]-5-methyl-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 10848171 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N-[3-[(E)-2-butoxyethenyl]-5-methyl-2-pyridinyl]acetamide |
| SMILES | CCCCO/C=C/c1cc(C)cnc1NC(C)=O |
| InChI | InChI=1S/C14H20N2O2/c1-4-5-7-18-8-6-13-9-11(2)10-15-14(13)16-12(3)17/h6,8-10H,4-5,7H2,1-3H3,(H,15,16,17)/b8-6+ |
| InChIKey | WZYOYWBBMCFRGI-SOFGYWHQSA-N |
| XLogP | 3.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|