C7H10ClN3O — CID 114998193
5-butoxy-3-chloro-1,2,4-triazine (PubChem CID 114998193) has the molecular formula C7H10ClN3O and a molecular weight of 187.63 g/mol. Its IUPAC name is 5-butoxy-3-chloro-1,2,4-triazine.
| Compound Name | 5-butoxy-3-chloro-1,2,4-triazine |
|---|---|
| PubChem CID | 114998193 |
| Molecular Formula | C7H10ClN3O |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 5-butoxy-3-chloro-1,2,4-triazine |
| SMILES | CCCCOc1cnnc(Cl)n1 |
| InChI | InChI=1S/C7H10ClN3O/c1-2-3-4-12-6-5-9-11-7(8)10-6/h5H,2-4H2,1H3 |
| InChIKey | WPEPGHLSSDKWAB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|