C14H21ClN2O2 — CID 167278323
(tert-butylamino)-[2-chloro-5-[(E)-2-ethoxyethenyl]-4-pyridinyl]methanol (PubChem CID 167278323) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is (tert-butylamino)-[2-chloro-5-[(E)-2-ethoxyethenyl]-4-pyridinyl]methanol.
| Compound Name | (tert-butylamino)-[2-chloro-5-[(E)-2-ethoxyethenyl]-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 167278323 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (tert-butylamino)-[2-chloro-5-[(E)-2-ethoxyethenyl]-4-pyridinyl]methanol |
| SMILES | CCO/C=C/c1cnc(Cl)cc1C(O)NC(C)(C)C |
| InChI | InChI=1S/C14H21ClN2O2/c1-5-19-7-6-10-9-16-12(15)8-11(10)13(18)17-14(2,3)4/h6-9,13,17-18H,5H2,1-4H3/b7-6+ |
| InChIKey | YKKKGHXVJBDTMU-VOTSOKGWSA-N |
| XLogP | 3.12 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|