C14H19ClN2O2 — CID 165400822
N-tert-butyl-6-chloro-3-[(E)-2-ethoxyethenyl]pyridine-2-carboxamide (PubChem CID 165400822) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is N-tert-butyl-6-chloro-3-[(E)-2-ethoxyethenyl]pyridine-2-carboxamide.
| Compound Name | N-tert-butyl-6-chloro-3-[(E)-2-ethoxyethenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 165400822 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-tert-butyl-6-chloro-3-[(E)-2-ethoxyethenyl]pyridine-2-carboxamide |
| SMILES | CCO/C=C/c1ccc(Cl)nc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H19ClN2O2/c1-5-19-9-8-10-6-7-11(15)16-12(10)13(18)17-14(2,3)4/h6-9H,5H2,1-4H3,(H,17,18)/b9-8+ |
| InChIKey | JYTNHCPYWYPVCL-CMDGGOBGSA-N |
| XLogP | 3.27 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|