C12H17ClN4O4 — CID 22160583
N-[2-chloro-4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxyamino]pyrimidin-5-yl]formamide (PubChem CID 22160583) has the molecular formula C12H17ClN4O4 and a molecular weight of 316.75 g/mol. Its IUPAC name is N-[2-chloro-4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxyamino]pyrimidin-5-yl]formamide.
| Compound Name | N-[2-chloro-4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxyamino]pyrimidin-5-yl]formamide |
|---|---|
| PubChem CID | 22160583 |
| Molecular Formula | C12H17ClN4O4 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-[2-chloro-4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxyamino]pyrimidin-5-yl]formamide |
| SMILES | CC1(C)OCC(CONc2nc(Cl)ncc2NC=O)CO1 |
| InChI | InChI=1S/C12H17ClN4O4/c1-12(2)19-4-8(5-20-12)6-21-17-10-9(15-7-18)3-14-11(13)16-10/h3,7-8H,4-6H2,1-2H3,(H,15,18)(H,14,16,17) |
| InChIKey | WDFAUPONLSLFGJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|