methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate

C15H20O5 — CID 69176328

IUPACmethyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate
SMILESCOC(=O)c1ccc(OCC2COC(C)(C)OC2)cc1
InChIInChI=1S/C15H20O5/c1-15(2)19-9-11(10-20-15)8-18-13-6-4-12(5-7-13)14(16)17-3/h4-7,11H,8-10H2,1-3H3
InChIKeyRWZCRYIHWBOSGX-UHFFFAOYSA-N
MW280.32 g/mol
LogP2.25
Rot. Bonds4

About methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate

methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate (PubChem CID 69176328) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate.

Molecular Properties

Compound Namemethyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate
PubChem CID69176328
Molecular FormulaC15H20O5
Molecular Weight280.32 g/mol
Exact Mass280.13
IUPAC Namemethyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate
SMILESCOC(=O)c1ccc(OCC2COC(C)(C)OC2)cc1
InChIInChI=1S/C15H20O5/c1-15(2)19-9-11(10-20-15)8-18-13-6-4-12(5-7-13)14(16)17-3/h4-7,11H,8-10H2,1-3H3
InChIKeyRWZCRYIHWBOSGX-UHFFFAOYSA-N
XLogP2.25
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.32
LogP ≤ 52.25
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate?
The IUPAC name of methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate (CID 69176328) is methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate.
What is the SMILES notation for methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate?
The canonical SMILES for methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate is COC(=O)c1ccc(OCC2COC(C)(C)OC2)cc1.
What is the InChIKey of methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate?
The InChIKey is RWZCRYIHWBOSGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O5/c1-15(2)19-9-11(10-20-15)8-18-13-6-4-12(5-7-13)14(16)17-3/h4-7,11H,8-10H2,1-3H3.
What are the key properties of methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate?
methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate has a molecular weight of 280.32 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate is sourced from PubChem (CID 69176328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).