C15H20O5 — CID 69176328
methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate (PubChem CID 69176328) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate.
| Compound Name | methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 69176328 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | methyl 4-[(2,2-dimethyl-1,3-dioxan-5-yl)methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC2COC(C)(C)OC2)cc1 |
| InChI | InChI=1S/C15H20O5/c1-15(2)19-9-11(10-20-15)8-18-13-6-4-12(5-7-13)14(16)17-3/h4-7,11H,8-10H2,1-3H3 |
| InChIKey | RWZCRYIHWBOSGX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |