C11H11NO2 — CID 11275503
3-[(E)-2-ethoxyethenyl]furo[2,3-c]pyridine (PubChem CID 11275503) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 3-[(E)-2-ethoxyethenyl]furo[2,3-c]pyridine.
| Compound Name | 3-[(E)-2-ethoxyethenyl]furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 11275503 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 3-[(E)-2-ethoxyethenyl]furo[2,3-c]pyridine |
| SMILES | CCO/C=C/c1coc2cnccc12 |
| InChI | InChI=1S/C11H11NO2/c1-2-13-6-4-9-8-14-11-7-12-5-3-10(9)11/h3-8H,2H2,1H3/b6-4+ |
| InChIKey | NTVIQKKXNKKARK-GQCTYLIASA-N |
| XLogP | 2.84 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|