C12H19NO — CID 156844588
ethane;3-methylfuro[2,3-c]pyridine (PubChem CID 156844588) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is ethane;3-methylfuro[2,3-c]pyridine.
| Compound Name | ethane;3-methylfuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 156844588 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | ethane;3-methylfuro[2,3-c]pyridine |
| SMILES | CC.CC.Cc1coc2cnccc12 |
| InChI | InChI=1S/C8H7NO.2C2H6/c1-6-5-10-8-4-9-3-2-7(6)8;2*1-2/h2-5H,1H3;2*1-2H3 |
| InChIKey | SAZJRGRZJKKDAS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |