3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid

C11H11NO3 — CID 84778212

IUPAC3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid
SMILESCC(Cc1coc2cnccc12)C(=O)O
InChIInChI=1S/C11H11NO3/c1-7(11(13)14)4-8-6-15-10-5-12-3-2-9(8)10/h2-3,5-7H,4H2,1H3,(H,13,14)
InChIKeyRLVJOUFWOPPPEL-UHFFFAOYSA-N
MW205.21 g/mol
LogP2.09
Rot. Bonds3

About 3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid

3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid (PubChem CID 84778212) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid.

Molecular Properties

Compound Name3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid
PubChem CID84778212
Molecular FormulaC11H11NO3
Molecular Weight205.21 g/mol
Exact Mass205.07
IUPAC Name3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid
SMILESCC(Cc1coc2cnccc12)C(=O)O
InChIInChI=1S/C11H11NO3/c1-7(11(13)14)4-8-6-15-10-5-12-3-2-9(8)10/h2-3,5-7H,4H2,1H3,(H,13,14)
InChIKeyRLVJOUFWOPPPEL-UHFFFAOYSA-N
XLogP2.09
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.21
LogP ≤ 52.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid?
The IUPAC name of 3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid (CID 84778212) is 3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid.
What is the SMILES notation for 3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid?
The canonical SMILES for 3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid is CC(Cc1coc2cnccc12)C(=O)O.
What is the InChIKey of 3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid?
The InChIKey is RLVJOUFWOPPPEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-7(11(13)14)4-8-6-15-10-5-12-3-2-9(8)10/h2-3,5-7H,4H2,1H3,(H,13,14).
What are the key properties of 3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid?
3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid has a molecular weight of 205.21 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-furo[2,3-c]pyridin-3-yl-2-methylpropanoic acid is sourced from PubChem (CID 84778212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).