C9H10ClNO2 — CID 139894647
3-(2-chloro-3-pyridinyl)-2-methylpropanoic acid (PubChem CID 139894647) has the molecular formula C9H10ClNO2 and a molecular weight of 199.64 g/mol. Its IUPAC name is 3-(2-chloro-3-pyridinyl)-2-methylpropanoic acid.
| Compound Name | 3-(2-chloro-3-pyridinyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 139894647 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 3-(2-chloro-3-pyridinyl)-2-methylpropanoic acid |
| SMILES | CC(Cc1cccnc1Cl)C(=O)O |
| InChI | InChI=1S/C9H10ClNO2/c1-6(9(12)13)5-7-3-2-4-11-8(7)10/h2-4,6H,5H2,1H3,(H,12,13) |
| InChIKey | QMEVDMRUHSJOIK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|